C34H39O11S3-3 — CID 5147925
8-octadec-9-enoyloxypyrene-1,3,6-trisulfonate (PubChem CID 5147925) has the molecular formula C34H39O11S3-3 and a molecular weight of 719.88 g/mol. Its IUPAC name is 8-octadec-9-enoyloxypyrene-1,3,6-trisulfonate.
| Compound Name | 8-octadec-9-enoyloxypyrene-1,3,6-trisulfonate |
|---|---|
| PubChem CID | 5147925 |
| Molecular Formula | C34H39O11S3-3 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.17 |
| IUPAC Name | 8-octadec-9-enoyloxypyrene-1,3,6-trisulfonate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Oc1cc(S(=O)(=O)[O-])c2ccc3c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c4ccc1c2c43 |
| InChI | InChI=1S/C34H42O11S3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-32(35)45-28-22-29(46(36,37)38)25-20-21-27-31(48(42,43)44)23-30(47(39,40)41)26-19-18-24(28)33(25)34(26)27/h9-10,18-23H,2-8,11-17H2,1H3,(H,36,37,38)(H,39,40,41)(H,42,43,44)/p-3 |
| InChIKey | KVAJISZWDPSXCI-UHFFFAOYSA-K |
| XLogP | 7.24 |
| TPSA | 197.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|