4-tridec-4-enoyloxybenzenesulfonic acid

C19H28O5S — CID 56624036

IUPAC4-tridec-4-enoyloxybenzenesulfonic acid
SMILESCCCCCCCCC=CCCC(=O)Oc1ccc(S(=O)(=O)O)cc1
InChIInChI=1S/C19H28O5S/c1-2-3-4-5-6-7-8-9-10-11-12-19(20)24-17-13-15-18(16-14-17)25(21,22)23/h9-10,13-16H,2-8,11-12H2,1H3,(H,21,22,23)
InChIKeyXLIOUHRWLNDGRE-UHFFFAOYSA-N
MW368.50 g/mol
LogP4.93
Rot. Bonds12

About 4-tridec-4-enoyloxybenzenesulfonic acid

4-tridec-4-enoyloxybenzenesulfonic acid (PubChem CID 56624036) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-tridec-4-enoyloxybenzenesulfonic acid.

Molecular Properties

Compound Name4-tridec-4-enoyloxybenzenesulfonic acid
PubChem CID56624036
Molecular FormulaC19H28O5S
Molecular Weight368.50 g/mol
Exact Mass368.17
IUPAC Name4-tridec-4-enoyloxybenzenesulfonic acid
SMILESCCCCCCCCC=CCCC(=O)Oc1ccc(S(=O)(=O)O)cc1
InChIInChI=1S/C19H28O5S/c1-2-3-4-5-6-7-8-9-10-11-12-19(20)24-17-13-15-18(16-14-17)25(21,22)23/h9-10,13-16H,2-8,11-12H2,1H3,(H,21,22,23)
InChIKeyXLIOUHRWLNDGRE-UHFFFAOYSA-N
XLogP4.93
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds12
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.50
LogP ≤ 54.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-tridec-4-enoyloxybenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-triacont-4-enoyloxybenzenesulfonic acid
CID 56612759
4-pentacos-4-enoyloxybenzenesulfonic acid
CID 56613888
4-heptacosanoyloxybenzenesulfonic acid
CID 56605558
4-octacosanoyloxybenzenesulfonic acid
CID 56632110
4-hexanoyloxybenzenesulfonic acid
CID 12010409
4-tetradec-2-enoyloxybenzenesulfonic acid
CID 56632393
4-heptadec-2-enoyloxybenzenesulfonic acid
CID 56610861
4-hex-4-enoyloxybenzenesulfonic acid
CID 56625825
4-[(Z)-octadec-9-enoxy]benzenesulfonic acid
CID 88620500
4-[7-[methyl(octanoyl)amino]heptanoyloxy]benzenesulfonic acid
CID 21129187
4-heptadec-5-en-6-yloxybenzenesulfonic acid
CID 175196983
4-[(Z)-dodec-6-enyl]benzenesulfonic acid
CID 138394953

Frequently Asked Questions

What is the IUPAC name of 4-tridec-4-enoyloxybenzenesulfonic acid?
The IUPAC name of 4-tridec-4-enoyloxybenzenesulfonic acid (CID 56624036) is 4-tridec-4-enoyloxybenzenesulfonic acid.
What is the SMILES notation for 4-tridec-4-enoyloxybenzenesulfonic acid?
The canonical SMILES for 4-tridec-4-enoyloxybenzenesulfonic acid is CCCCCCCCC=CCCC(=O)Oc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 4-tridec-4-enoyloxybenzenesulfonic acid?
The InChIKey is XLIOUHRWLNDGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O5S/c1-2-3-4-5-6-7-8-9-10-11-12-19(20)24-17-13-15-18(16-14-17)25(21,22)23/h9-10,13-16H,2-8,11-12H2,1H3,(H,21,22,23).
What are the key properties of 4-tridec-4-enoyloxybenzenesulfonic acid?
4-tridec-4-enoyloxybenzenesulfonic acid has a molecular weight of 368.50 g/mol, XLogP of 4.93, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tridec-4-enoyloxybenzenesulfonic acid is sourced from PubChem (CID 56624036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).