C21H15O6S- — CID 167712648
6-hydroxy-3-methyl-8-(2-methylprop-2-enoyloxy)pyrene-1-sulfonate (PubChem CID 167712648) has the molecular formula C21H15O6S- and a molecular weight of 395.41 g/mol. Its IUPAC name is 6-hydroxy-3-methyl-8-(2-methylprop-2-enoyloxy)pyrene-1-sulfonate.
| Compound Name | 6-hydroxy-3-methyl-8-(2-methylprop-2-enoyloxy)pyrene-1-sulfonate |
|---|---|
| PubChem CID | 167712648 |
| Molecular Formula | C21H15O6S- |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 6-hydroxy-3-methyl-8-(2-methylprop-2-enoyloxy)pyrene-1-sulfonate |
| SMILES | C=C(C)C(=O)Oc1cc(O)c2ccc3c(C)cc(S(=O)(=O)[O-])c4ccc1c2c34 |
| InChI | InChI=1S/C21H16O6S/c1-10(2)21(23)27-17-9-16(22)13-5-4-12-11(3)8-18(28(24,25)26)15-7-6-14(17)20(13)19(12)15/h4-9,22H,1H2,2-3H3,(H,24,25,26)/p-1 |
| InChIKey | KCDMNPZSMMGMSZ-UHFFFAOYSA-M |
| XLogP | 3.98 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|