C25H26NO5S- — CID 58234194
3,6-dimethyl-8-[6-(methylamino)-6-oxohexoxy]pyrene-1-sulfonate (PubChem CID 58234194) has the molecular formula C25H26NO5S- and a molecular weight of 452.55 g/mol. Its IUPAC name is 3,6-dimethyl-8-[6-(methylamino)-6-oxohexoxy]pyrene-1-sulfonate.
| Compound Name | 3,6-dimethyl-8-[6-(methylamino)-6-oxohexoxy]pyrene-1-sulfonate |
|---|---|
| PubChem CID | 58234194 |
| Molecular Formula | C25H26NO5S- |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3,6-dimethyl-8-[6-(methylamino)-6-oxohexoxy]pyrene-1-sulfonate |
| SMILES | CNC(=O)CCCCCOc1cc(C)c2ccc3c(C)cc(S(=O)(=O)[O-])c4ccc1c2c34 |
| InChI | InChI=1S/C25H27NO5S/c1-15-13-21(31-12-6-4-5-7-23(27)26-3)19-10-11-20-22(32(28,29)30)14-16(2)18-9-8-17(15)24(19)25(18)20/h8-11,13-14H,4-7,12H2,1-3H3,(H,26,27)(H,28,29,30)/p-1 |
| InChIKey | WKPGIUXBZPGUOB-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|