C28H26NO8S- — CID 58234187
8-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexoxy]-3,6-dimethylpyrene-1-sulfonate (PubChem CID 58234187) has the molecular formula C28H26NO8S- and a molecular weight of 536.58 g/mol. Its IUPAC name is 8-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexoxy]-3,6-dimethylpyrene-1-sulfonate.
| Compound Name | 8-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexoxy]-3,6-dimethylpyrene-1-sulfonate |
|---|---|
| PubChem CID | 58234187 |
| Molecular Formula | C28H26NO8S- |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 8-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexoxy]-3,6-dimethylpyrene-1-sulfonate |
| SMILES | Cc1cc(OCCCCCC(=O)ON2C(=O)CCC2=O)c2ccc3c(S(=O)(=O)[O-])cc(C)c4ccc1c2c43 |
| InChI | InChI=1S/C28H27NO8S/c1-16-14-22(36-13-5-3-4-6-26(32)37-29-24(30)11-12-25(29)31)20-9-10-21-23(38(33,34)35)15-17(2)19-8-7-18(16)27(20)28(19)21/h7-10,14-15H,3-6,11-13H2,1-2H3,(H,33,34,35)/p-1 |
| InChIKey | WILODYWIAQQFAJ-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|