C16H16Cl3NO5 — CID 23078138
(2,5-dioxopyrrolidin-1-yl) 6-(2,4,5-trichlorophenoxy)hexanoate (PubChem CID 23078138) has the molecular formula C16H16Cl3NO5 and a molecular weight of 408.67 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(2,4,5-trichlorophenoxy)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,4,5-trichlorophenoxy)hexanoate |
|---|---|
| PubChem CID | 23078138 |
| Molecular Formula | C16H16Cl3NO5 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,4,5-trichlorophenoxy)hexanoate |
| SMILES | O=C(CCCCCOc1cc(Cl)c(Cl)cc1Cl)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H16Cl3NO5/c17-10-8-12(19)13(9-11(10)18)24-7-3-1-2-4-16(23)25-20-14(21)5-6-15(20)22/h8-9H,1-7H2 |
| InChIKey | ZXECTMFKEFIPLI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|