C18H22ClNO5 — CID 10270350
(2,5-dioxopyrrolidin-1-yl) 6-(4-chloro-3,5-dimethylphenoxy)hexanoate (PubChem CID 10270350) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(4-chloro-3,5-dimethylphenoxy)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(4-chloro-3,5-dimethylphenoxy)hexanoate |
|---|---|
| PubChem CID | 10270350 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(4-chloro-3,5-dimethylphenoxy)hexanoate |
| SMILES | Cc1cc(OCCCCCC(=O)ON2C(=O)CCC2=O)cc(C)c1Cl |
| InChI | InChI=1S/C18H22ClNO5/c1-12-10-14(11-13(2)18(12)19)24-9-5-3-4-6-17(23)25-20-15(21)7-8-16(20)22/h10-11H,3-9H2,1-2H3 |
| InChIKey | CMOVCDQCAKTSAH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|