C13H23BrN2O4 — CID 87129877
[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-trimethylazanium bromide (PubChem CID 87129877) has the molecular formula C13H23BrN2O4 and a molecular weight of 351.24 g/mol. Its IUPAC name is [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-trimethylazanium bromide.
| Compound Name | [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 87129877 |
| Molecular Formula | C13H23BrN2O4 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CCCCCC(=O)ON1C(=O)CCC1=O.[Br-] |
| InChI | InChI=1S/C13H23N2O4.BrH/c1-15(2,3)10-6-4-5-7-13(18)19-14-11(16)8-9-12(14)17;/h4-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ABAKXBQUMIDTLY-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|