C21H29NO5 — CID 175002043
(2,5-dioxopyrrolidin-1-yl) 5-(2,4,6-triethylphenoxy)pentanoate (PubChem CID 175002043) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(2,4,6-triethylphenoxy)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,4,6-triethylphenoxy)pentanoate |
|---|---|
| PubChem CID | 175002043 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,4,6-triethylphenoxy)pentanoate |
| SMILES | CCc1cc(CC)c(OCCCCC(=O)ON2C(=O)CCC2=O)c(CC)c1 |
| InChI | InChI=1S/C21H29NO5/c1-4-15-13-16(5-2)21(17(6-3)14-15)26-12-8-7-9-20(25)27-22-18(23)10-11-19(22)24/h13-14H,4-12H2,1-3H3 |
| InChIKey | NEGPWCFPNGDAQW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|