C20H13N2O8S2- — CID 162158423
6-methyl-8-[2-(methylideneazaniumylideneamino)-2-oxoethoxy]pyrene-1,3-disulfonate (PubChem CID 162158423) has the molecular formula C20H13N2O8S2- and a molecular weight of 473.46 g/mol. Its IUPAC name is 6-methyl-8-[2-(methylideneazaniumylideneamino)-2-oxoethoxy]pyrene-1,3-disulfonate.
| Compound Name | 6-methyl-8-[2-(methylideneazaniumylideneamino)-2-oxoethoxy]pyrene-1,3-disulfonate |
|---|---|
| PubChem CID | 162158423 |
| Molecular Formula | C20H13N2O8S2- |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 6-methyl-8-[2-(methylideneazaniumylideneamino)-2-oxoethoxy]pyrene-1,3-disulfonate |
| SMILES | C=[N+]=NC(=O)COc1cc(C)c2ccc3c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c4ccc1c2c34 |
| InChI | InChI=1S/C20H14N2O8S2/c1-10-7-15(30-9-18(23)22-21-2)12-4-6-14-17(32(27,28)29)8-16(31(24,25)26)13-5-3-11(10)19(12)20(13)14/h3-8H,2,9H2,1H3,(H-,24,25,26,27,28,29)/p-1 |
| InChIKey | INAMKLDCWXNCRO-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 167.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|