C32H36N2O8S — CID 88558031
6-[[1-[2-(3,6-dimethyl-8-sulfopyren-1-yl)oxyacetyl]piperidine-4-carbonyl]amino]hexanoic acid (PubChem CID 88558031) has the molecular formula C32H36N2O8S and a molecular weight of 608.71 g/mol. Its IUPAC name is 6-[[1-[2-(3,6-dimethyl-8-sulfopyren-1-yl)oxyacetyl]piperidine-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-[2-(3,6-dimethyl-8-sulfopyren-1-yl)oxyacetyl]piperidine-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 88558031 |
| Molecular Formula | C32H36N2O8S |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 6-[[1-[2-(3,6-dimethyl-8-sulfopyren-1-yl)oxyacetyl]piperidine-4-carbonyl]amino]hexanoic acid |
| SMILES | Cc1cc(OCC(=O)N2CCC(C(=O)NCCCCCC(=O)O)CC2)c2ccc3c(S(=O)(=O)O)cc(C)c4ccc1c2c43 |
| InChI | InChI=1S/C32H36N2O8S/c1-19-16-26(24-9-10-25-27(43(39,40)41)17-20(2)23-8-7-22(19)30(24)31(23)25)42-18-28(35)34-14-11-21(12-15-34)32(38)33-13-5-3-4-6-29(36)37/h7-10,16-17,21H,3-6,11-15,18H2,1-2H3,(H,33,38)(H,36,37)(H,39,40,41) |
| InChIKey | SLZVPKOHJNZIGZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|