C22H27N3O4S2 — CID 55954715
N-(3-methoxypropyl)-1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxamide (PubChem CID 55954715) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55954715 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-(3-methoxypropyl)-1-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)COc2cc3sc(C)nc3c3sccc23)CC1 |
| InChI | InChI=1S/C22H27N3O4S2/c1-14-24-20-18(31-14)12-17(16-6-11-30-21(16)20)29-13-19(26)25-8-4-15(5-9-25)22(27)23-7-3-10-28-2/h6,11-12,15H,3-5,7-10,13H2,1-2H3,(H,23,27) |
| InChIKey | OOMGNURDJFDSSH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|