C22H28N4O4S2 — CID 55694016
N-(3-methoxypropyl)-2-[4-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperazin-1-yl]acetamide (PubChem CID 55694016) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55694016 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)COc2cc3sc(C)nc3c3sccc23)CC1 |
| InChI | InChI=1S/C22H28N4O4S2/c1-15-24-21-18(32-15)12-17(16-4-11-31-22(16)21)30-14-20(28)26-8-6-25(7-9-26)13-19(27)23-5-3-10-29-2/h4,11-12H,3,5-10,13-14H2,1-2H3,(H,23,27) |
| InChIKey | IOIJVQMQIBVUGN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|