C17H12BrN3O3S3 — CID 55694017
5-bromo-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]thiophene-2-carbohydrazide (PubChem CID 55694017) has the molecular formula C17H12BrN3O3S3 and a molecular weight of 482.41 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55694017 |
| Molecular Formula | C17H12BrN3O3S3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 480.92 |
| IUPAC Name | 5-bromo-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]thiophene-2-carbohydrazide |
| SMILES | Cc1nc2c(cc(OCC(=O)NNC(=O)c3ccc(Br)s3)c3ccsc32)s1 |
| InChI | InChI=1S/C17H12BrN3O3S3/c1-8-19-15-12(26-8)6-10(9-4-5-25-16(9)15)24-7-14(22)20-21-17(23)11-2-3-13(18)27-11/h2-6H,7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OPWYSLIXSANYKK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|