C17H18N2O4S2 — CID 95143080
2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-N-[(2S)-oxan-2-yl]oxyacetamide (PubChem CID 95143080) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-N-[(2S)-oxan-2-yl]oxyacetamide.
| Compound Name | 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-N-[(2S)-oxan-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 95143080 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-N-[(2S)-oxan-2-yl]oxyacetamide |
| SMILES | Cc1nc2c(cc(OCC(=O)NO[C@H]3CCCCO3)c3ccsc32)s1 |
| InChI | InChI=1S/C17H18N2O4S2/c1-10-18-16-13(25-10)8-12(11-5-7-24-17(11)16)22-9-14(20)19-23-15-4-2-3-6-21-15/h5,7-8,15H,2-4,6,9H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | KJRQITIRDRNEGN-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|