C19H14FN3O3S2 — CID 46489302
2-fluoro-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]benzohydrazide (PubChem CID 46489302) has the molecular formula C19H14FN3O3S2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]benzohydrazide |
|---|---|
| PubChem CID | 46489302 |
| Molecular Formula | C19H14FN3O3S2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-fluoro-N'-[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]benzohydrazide |
| SMILES | Cc1nc2c(cc(OCC(=O)NNC(=O)c3ccccc3F)c3ccsc32)s1 |
| InChI | InChI=1S/C19H14FN3O3S2/c1-10-21-17-15(28-10)8-14(12-6-7-27-18(12)17)26-9-16(24)22-23-19(25)11-4-2-3-5-13(11)20/h2-8H,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | QJSHGMHHETUHQW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|