C12H9F2N3O2S2 — CID 63576313
2,2-difluoro-2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetohydrazide (PubChem CID 63576313) has the molecular formula C12H9F2N3O2S2 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2,2-difluoro-2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetohydrazide.
| Compound Name | 2,2-difluoro-2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetohydrazide |
|---|---|
| PubChem CID | 63576313 |
| Molecular Formula | C12H9F2N3O2S2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2,2-difluoro-2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetohydrazide |
| SMILES | Cc1nc2c(cc(OC(F)(F)C(=O)NN)c3ccsc32)s1 |
| InChI | InChI=1S/C12H9F2N3O2S2/c1-5-16-9-8(21-5)4-7(6-2-3-20-10(6)9)19-12(13,14)11(18)17-15/h2-4H,15H2,1H3,(H,17,18) |
| InChIKey | YQHFRDOWBRRXPE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|