C14H14N4O3S2 — CID 75479913
1-methyl-3-[[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]amino]urea (PubChem CID 75479913) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-methyl-3-[[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]amino]urea.
| Compound Name | 1-methyl-3-[[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]amino]urea |
|---|---|
| PubChem CID | 75479913 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 1-methyl-3-[[2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetyl]amino]urea |
| SMILES | CNC(=O)NNC(=O)COc1cc2sc(C)nc2c2sccc12 |
| InChI | InChI=1S/C14H14N4O3S2/c1-7-16-12-10(23-7)5-9(8-3-4-22-13(8)12)21-6-11(19)17-18-14(20)15-2/h3-5H,6H2,1-2H3,(H,17,19)(H2,15,18,20) |
| InChIKey | JLTLCHZGUDMFMD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|