About 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol
3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol (PubChem CID 114495960) has the molecular formula C16H19NO2S2
and a molecular weight of 321.47 g/mol. Its IUPAC name is 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol |
| PubChem CID | 114495960 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol |
| SMILES | CCC(O)(CC)COc1cc2sc(C)nc2c2sccc12 |
| InChI | InChI=1S/C16H19NO2S2/c1-4-16(18,5-2)9-19-12-8-13-14(17-10(3)21-13)15-11(12)6-7-20-15/h6-8,18H,4-5,9H2,1-3H3 |
| InChIKey | MIBXPBSHDPWGEE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol?
The IUPAC name of 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol (CID 114495960) is 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol.
What is the SMILES notation for 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol?
The canonical SMILES for 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol is CCC(O)(CC)COc1cc2sc(C)nc2c2sccc12.
What is the InChIKey of 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol?
The InChIKey is MIBXPBSHDPWGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S2/c1-4-16(18,5-2)9-19-12-8-13-14(17-10(3)21-13)15-11(12)6-7-20-15/h6-8,18H,4-5,9H2,1-3H3.
What are the key properties of 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol?
3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol has a molecular weight of 321.47 g/mol, XLogP of 4.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxymethyl]pentan-3-ol is sourced from PubChem (CID 114495960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).