C16H18O4 — CID 140889355
[3,6-dimethyl-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 140889355) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is [3,6-dimethyl-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [3,6-dimethyl-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140889355 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [3,6-dimethyl-2-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)ccc(C)c1OC(=O)C(=C)C |
| InChI | InChI=1S/C16H18O4/c1-9(2)15(17)19-13-11(5)7-8-12(6)14(13)20-16(18)10(3)4/h7-8H,1,3H2,2,4-6H3 |
| InChIKey | QOAGSMABDHXAJJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|