C24H26O5 — CID 59739252
[4-[2,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenoxy]-2,5-dimethylphenyl] 2-methylprop-2-enoate (PubChem CID 59739252) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [4-[2,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenoxy]-2,5-dimethylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenoxy]-2,5-dimethylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59739252 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [4-[2,5-dimethyl-4-(2-methylprop-2-enoyloxy)phenoxy]-2,5-dimethylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(C)c(Oc2cc(C)c(OC(=O)C(=C)C)cc2C)cc1C |
| InChI | InChI=1S/C24H26O5/c1-13(2)23(25)28-21-11-15(5)19(9-17(21)7)27-20-10-18(8)22(12-16(20)6)29-24(26)14(3)4/h9-12H,1,3H2,2,4-8H3 |
| InChIKey | STSDBEYFGOHTLZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|