C36H36IO5+ — CID 163544449
(4-tert-butylphenyl)-[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyphenoxy]-2-methylphenyl]iodanium (PubChem CID 163544449) has the molecular formula C36H36IO5+ and a molecular weight of 675.58 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyphenoxy]-2-methylphenyl]iodanium.
| Compound Name | (4-tert-butylphenyl)-[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyphenoxy]-2-methylphenyl]iodanium |
|---|---|
| PubChem CID | 163544449 |
| Molecular Formula | C36H36IO5+ |
| Molecular Weight | 675.58 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | (4-tert-butylphenyl)-[4-[2,5-dimethyl-4-[4-(2-methylprop-2-enoyloxy)benzoyl]oxyphenoxy]-2-methylphenyl]iodanium |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)Oc2cc(C)c(Oc3ccc([I+]c4ccc(C(C)(C)C)cc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C36H36IO5/c1-22(2)34(38)41-29-15-9-26(10-16-29)35(39)42-33-21-24(4)32(20-25(33)5)40-30-17-18-31(23(3)19-30)37-28-13-11-27(12-14-28)36(6,7)8/h9-21H,1H2,2-8H3/q+1 |
| InChIKey | FDUYWKTVJYHDIX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|