C18H18O5 — CID 139991122
4-(4-carboxy-2,5-dimethylphenoxy)-2,5-dimethylbenzoic acid (PubChem CID 139991122) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-(4-carboxy-2,5-dimethylphenoxy)-2,5-dimethylbenzoic acid.
| Compound Name | 4-(4-carboxy-2,5-dimethylphenoxy)-2,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 139991122 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-(4-carboxy-2,5-dimethylphenoxy)-2,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(C)cc1Oc1cc(C)c(C(=O)O)cc1C |
| InChI | InChI=1S/C18H18O5/c1-9-7-15(11(3)5-13(9)17(19)20)23-16-8-10(2)14(18(21)22)6-12(16)4/h5-8H,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | RUZOGMMADNVUKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |