C12H18O3 — CID 145075043
ethane;4-methoxy-2,5-dimethylbenzoic acid (PubChem CID 145075043) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is ethane;4-methoxy-2,5-dimethylbenzoic acid.
| Compound Name | ethane;4-methoxy-2,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 145075043 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | ethane;4-methoxy-2,5-dimethylbenzoic acid |
| SMILES | CC.COc1cc(C)c(C(=O)O)cc1C |
| InChI | InChI=1S/C10H12O3.C2H6/c1-6-5-9(13-3)7(2)4-8(6)10(11)12;1-2/h4-5H,1-3H3,(H,11,12);1-2H3 |
| InChIKey | UKILRGAIXYJGGB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |