C15H13FO5S — CID 21463773
4-(4-fluorophenoxy)-2-methyl-5-methylsulfonylbenzoic acid (PubChem CID 21463773) has the molecular formula C15H13FO5S and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-2-methyl-5-methylsulfonylbenzoic acid.
| Compound Name | 4-(4-fluorophenoxy)-2-methyl-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 21463773 |
| Molecular Formula | C15H13FO5S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-(4-fluorophenoxy)-2-methyl-5-methylsulfonylbenzoic acid |
| SMILES | Cc1cc(Oc2ccc(F)cc2)c(S(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C15H13FO5S/c1-9-7-13(21-11-5-3-10(16)4-6-11)14(22(2,19)20)8-12(9)15(17)18/h3-8H,1-2H3,(H,17,18) |
| InChIKey | FZXCBFBZVQSFRW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |