C17H19ClF5N3O6S3 — CID 131727142
N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-[4-methylsulfonyl-3-(pentafluoro-λ6-sulfanyl)phenoxy]benzamide;hydrochloride (PubChem CID 131727142) has the molecular formula C17H19ClF5N3O6S3 and a molecular weight of 588.00 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-[4-methylsulfonyl-3-(pentafluoro-λ6-sulfanyl)phenoxy]benzamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-[4-methylsulfonyl-3-(pentafluoro-λ6-sulfanyl)phenoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 131727142 |
| Molecular Formula | C17H19ClF5N3O6S3 |
| Molecular Weight | 588.00 g/mol |
| Exact Mass | 587.00 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-5-methylsulfonyl-4-[4-methylsulfonyl-3-(pentafluoro-λ6-sulfanyl)phenoxy]benzamide;hydrochloride |
| SMILES | Cc1cc(Oc2ccc(S(C)(=O)=O)c(S(F)(F)(F)(F)F)c2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N.Cl |
| InChI | InChI=1S/C17H18F5N3O6S3.ClH/c1-9-6-12(14(33(3,29)30)8-11(9)16(26)25-17(23)24)31-10-4-5-13(32(2,27)28)15(7-10)34(18,19,20,21)22;/h4-8H,1-3H3,(H4,23,24,25,26);1H |
| InChIKey | OCVLJXZFTKORJI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|