C12H16N2O2 — CID 134554194
[2,6-bis(methylamino)phenyl] 2-methylprop-2-enoate (PubChem CID 134554194) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is [2,6-bis(methylamino)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2,6-bis(methylamino)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134554194 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | [2,6-bis(methylamino)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(NC)cccc1NC |
| InChI | InChI=1S/C12H16N2O2/c1-8(2)12(15)16-11-9(13-3)6-5-7-10(11)14-4/h5-7,13-14H,1H2,2-4H3 |
| InChIKey | VQURFCKDENRPKB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|