C20H18O4 — CID 163406656
(10-acetyloxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406656) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (10-acetyloxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (10-acetyloxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406656 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (10-acetyloxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC(C)=O)c3ccccc13)CC=CC2 |
| InChI | InChI=1S/C20H18O4/c1-12(2)20(22)24-19-16-10-6-4-8-14(16)18(23-13(3)21)15-9-5-7-11-17(15)19/h4-8,10H,1,9,11H2,2-3H3 |
| InChIKey | YBWHOJPEIVIZMC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|