C18H15ClO3 — CID 163407031
(2-chloro-10-hydroxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163407031) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is (2-chloro-10-hydroxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (2-chloro-10-hydroxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163407031 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2-chloro-10-hydroxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(O)c3ccccc13)CC=C(Cl)C2 |
| InChI | InChI=1S/C18H15ClO3/c1-10(2)18(21)22-17-14-6-4-3-5-12(14)16(20)13-8-7-11(19)9-15(13)17/h3-7,20H,1,8-9H2,2H3 |
| InChIKey | ZVNCZDLBADFEHR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|