C18H16Cl2O3 — CID 163406920
(2,6-dichloro-10-hydroxy-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406920) has the molecular formula C18H16Cl2O3 and a molecular weight of 351.23 g/mol. Its IUPAC name is (2,6-dichloro-10-hydroxy-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (2,6-dichloro-10-hydroxy-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406920 |
| Molecular Formula | C18H16Cl2O3 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2,6-dichloro-10-hydroxy-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(O)c3cc(Cl)ccc13)CCC(Cl)C2 |
| InChI | InChI=1S/C18H16Cl2O3/c1-9(2)18(22)23-17-13-6-4-10(19)7-14(13)16(21)12-5-3-11(20)8-15(12)17/h4,6-7,11,21H,1,3,5,8H2,2H3 |
| InChIKey | OVNYECFNXADFSA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|