C19H16Cl2O3 — CID 163406999
(2,6-dichloro-10-methoxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406999) has the molecular formula C19H16Cl2O3 and a molecular weight of 363.24 g/mol. Its IUPAC name is (2,6-dichloro-10-methoxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (2,6-dichloro-10-methoxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406999 |
| Molecular Formula | C19H16Cl2O3 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2,6-dichloro-10-methoxy-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC)c3cc(Cl)ccc13)CC=C(Cl)C2 |
| InChI | InChI=1S/C19H16Cl2O3/c1-10(2)19(22)24-18-14-7-5-11(20)8-15(14)17(23-3)13-6-4-12(21)9-16(13)18/h4-5,7-8H,1,6,9H2,2-3H3 |
| InChIKey | AZMRSPVZTVGJOA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|