C20H16Cl2O4 — CID 163406985
(10-acetyloxy-2,6-dichloro-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406985) has the molecular formula C20H16Cl2O4 and a molecular weight of 391.25 g/mol. Its IUPAC name is (10-acetyloxy-2,6-dichloro-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (10-acetyloxy-2,6-dichloro-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406985 |
| Molecular Formula | C20H16Cl2O4 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | (10-acetyloxy-2,6-dichloro-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC(C)=O)c3cc(Cl)ccc13)CC=C(Cl)C2 |
| InChI | InChI=1S/C20H16Cl2O4/c1-10(2)20(24)26-19-15-7-5-12(21)8-16(15)18(25-11(3)23)14-6-4-13(22)9-17(14)19/h4-5,7-8H,1,6,9H2,2-3H3 |
| InChIKey | RYQNSDROLLZNJZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|