C22H21ClO4 — CID 163406716
(10-acetyloxy-6-chloro-2-ethyl-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406716) has the molecular formula C22H21ClO4 and a molecular weight of 384.86 g/mol. Its IUPAC name is (10-acetyloxy-6-chloro-2-ethyl-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (10-acetyloxy-6-chloro-2-ethyl-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406716 |
| Molecular Formula | C22H21ClO4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (10-acetyloxy-6-chloro-2-ethyl-1,4-dihydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC(C)=O)c3cc(Cl)ccc13)CC=C(CC)C2 |
| InChI | InChI=1S/C22H21ClO4/c1-5-14-6-8-16-18(10-14)21(27-22(25)12(2)3)17-9-7-15(23)11-19(17)20(16)26-13(4)24/h6-7,9,11H,2,5,8,10H2,1,3-4H3 |
| InChIKey | HWYRLPNNFKIRHI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|