C23H22Cl2O5 — CID 23038575
[6-chloro-4-[(4-chlorophenyl)methoxy]-2,3-diethoxynaphthalen-1-yl] acetate (PubChem CID 23038575) has the molecular formula C23H22Cl2O5 and a molecular weight of 449.33 g/mol. Its IUPAC name is [6-chloro-4-[(4-chlorophenyl)methoxy]-2,3-diethoxynaphthalen-1-yl] acetate.
| Compound Name | [6-chloro-4-[(4-chlorophenyl)methoxy]-2,3-diethoxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 23038575 |
| Molecular Formula | C23H22Cl2O5 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | [6-chloro-4-[(4-chlorophenyl)methoxy]-2,3-diethoxynaphthalen-1-yl] acetate |
| SMILES | CCOc1c(OCC)c(OC(C)=O)c2ccc(Cl)cc2c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2O5/c1-4-27-22-20(29-13-15-6-8-16(24)9-7-15)19-12-17(25)10-11-18(19)21(30-14(3)26)23(22)28-5-2/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | KHDNFBUQHPDHKF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|