C28H30Cl2O6 — CID 23038401
[7-chloro-4-(2,2-dimethylpentanoyloxy)-2,3-diethoxynaphthalen-1-yl] 2-chlorobenzoate (PubChem CID 23038401) has the molecular formula C28H30Cl2O6 and a molecular weight of 533.45 g/mol. Its IUPAC name is [7-chloro-4-(2,2-dimethylpentanoyloxy)-2,3-diethoxynaphthalen-1-yl] 2-chlorobenzoate.
| Compound Name | [7-chloro-4-(2,2-dimethylpentanoyloxy)-2,3-diethoxynaphthalen-1-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 23038401 |
| Molecular Formula | C28H30Cl2O6 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | [7-chloro-4-(2,2-dimethylpentanoyloxy)-2,3-diethoxynaphthalen-1-yl] 2-chlorobenzoate |
| SMILES | CCCC(C)(C)C(=O)Oc1c(OCC)c(OCC)c(OC(=O)c2ccccc2Cl)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C28H30Cl2O6/c1-6-15-28(4,5)27(32)36-22-18-14-13-17(29)16-20(18)23(25(34-8-3)24(22)33-7-2)35-26(31)19-11-9-10-12-21(19)30/h9-14,16H,6-8,15H2,1-5H3 |
| InChIKey | RHZXSDUEABHFKH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|