C31H38ClFO6 — CID 67897943
[6-chloro-4-(2,2-dimethylhexanoyloxy)-2,3-dipropoxynaphthalen-1-yl] 1-fluorocyclohexa-2,4-diene-1-carboxylate (PubChem CID 67897943) has the molecular formula C31H38ClFO6 and a molecular weight of 561.09 g/mol. Its IUPAC name is [6-chloro-4-(2,2-dimethylhexanoyloxy)-2,3-dipropoxynaphthalen-1-yl] 1-fluorocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [6-chloro-4-(2,2-dimethylhexanoyloxy)-2,3-dipropoxynaphthalen-1-yl] 1-fluorocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 67897943 |
| Molecular Formula | C31H38ClFO6 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [6-chloro-4-(2,2-dimethylhexanoyloxy)-2,3-dipropoxynaphthalen-1-yl] 1-fluorocyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCC(C)(C)C(=O)Oc1c(OCCC)c(OCCC)c(OC(=O)C2(F)C=CC=CC2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C31H38ClFO6/c1-6-9-15-30(4,5)28(34)38-25-23-20-21(32)13-14-22(23)24(26(36-18-7-2)27(25)37-19-8-3)39-29(35)31(33)16-11-10-12-17-31/h10-14,16,20H,6-9,15,17-19H2,1-5H3 |
| InChIKey | GAOGFCHIJNVYCF-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|