C27H28ClFO6 — CID 149158565
(4-butanoyloxy-6-chloro-2,3-dipropoxynaphthalen-1-yl) 4-fluorobenzoate (PubChem CID 149158565) has the molecular formula C27H28ClFO6 and a molecular weight of 502.97 g/mol. Its IUPAC name is (4-butanoyloxy-6-chloro-2,3-dipropoxynaphthalen-1-yl) 4-fluorobenzoate.
| Compound Name | (4-butanoyloxy-6-chloro-2,3-dipropoxynaphthalen-1-yl) 4-fluorobenzoate |
|---|---|
| PubChem CID | 149158565 |
| Molecular Formula | C27H28ClFO6 |
| Molecular Weight | 502.97 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (4-butanoyloxy-6-chloro-2,3-dipropoxynaphthalen-1-yl) 4-fluorobenzoate |
| SMILES | CCCOc1c(OCCC)c(OC(=O)c2ccc(F)cc2)c2ccc(Cl)cc2c1OC(=O)CCC |
| InChI | InChI=1S/C27H28ClFO6/c1-4-7-22(30)34-24-21-16-18(28)10-13-20(21)23(25(32-14-5-2)26(24)33-15-6-3)35-27(31)17-8-11-19(29)12-9-17/h8-13,16H,4-7,14-15H2,1-3H3 |
| InChIKey | DIXQFOCZABTERY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.97 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|