C26H29ClO6 — CID 23038898
(7-chloro-4-hydroxy-2,3-dipropoxynaphthalen-1-yl) 2-(4-ethoxyphenyl)acetate (PubChem CID 23038898) has the molecular formula C26H29ClO6 and a molecular weight of 472.97 g/mol. Its IUPAC name is (7-chloro-4-hydroxy-2,3-dipropoxynaphthalen-1-yl) 2-(4-ethoxyphenyl)acetate.
| Compound Name | (7-chloro-4-hydroxy-2,3-dipropoxynaphthalen-1-yl) 2-(4-ethoxyphenyl)acetate |
|---|---|
| PubChem CID | 23038898 |
| Molecular Formula | C26H29ClO6 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (7-chloro-4-hydroxy-2,3-dipropoxynaphthalen-1-yl) 2-(4-ethoxyphenyl)acetate |
| SMILES | CCCOc1c(OCCC)c(OC(=O)Cc2ccc(OCC)cc2)c2cc(Cl)ccc2c1O |
| InChI | InChI=1S/C26H29ClO6/c1-4-13-31-25-23(29)20-12-9-18(27)16-21(20)24(26(25)32-14-5-2)33-22(28)15-17-7-10-19(11-8-17)30-6-3/h7-12,16,29H,4-6,13-15H2,1-3H3 |
| InChIKey | STCQVYHYHRSGCQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|