C32H33ClO5 — CID 54240287
[6-chloro-4-[2-(4-ethylphenyl)ethoxy]-2,3-dimethoxynaphthalen-1-yl] 2-(4-ethylphenyl)acetate (PubChem CID 54240287) has the molecular formula C32H33ClO5 and a molecular weight of 533.06 g/mol. Its IUPAC name is [6-chloro-4-[2-(4-ethylphenyl)ethoxy]-2,3-dimethoxynaphthalen-1-yl] 2-(4-ethylphenyl)acetate.
| Compound Name | [6-chloro-4-[2-(4-ethylphenyl)ethoxy]-2,3-dimethoxynaphthalen-1-yl] 2-(4-ethylphenyl)acetate |
|---|---|
| PubChem CID | 54240287 |
| Molecular Formula | C32H33ClO5 |
| Molecular Weight | 533.06 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [6-chloro-4-[2-(4-ethylphenyl)ethoxy]-2,3-dimethoxynaphthalen-1-yl] 2-(4-ethylphenyl)acetate |
| SMILES | CCc1ccc(CCOc2c(OC)c(OC)c(OC(=O)Cc3ccc(CC)cc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C32H33ClO5/c1-5-21-7-11-23(12-8-21)17-18-37-29-27-20-25(33)15-16-26(27)30(32(36-4)31(29)35-3)38-28(34)19-24-13-9-22(6-2)10-14-24/h7-16,20H,5-6,17-19H2,1-4H3 |
| InChIKey | QPNKAYZUFCTCPZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.06 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|