C19H24O5 — CID 23038323
(2,3-dimethoxy-6-methyl-4-propoxynaphthalen-1-yl) propanoate (PubChem CID 23038323) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2,3-dimethoxy-6-methyl-4-propoxynaphthalen-1-yl) propanoate.
| Compound Name | (2,3-dimethoxy-6-methyl-4-propoxynaphthalen-1-yl) propanoate |
|---|---|
| PubChem CID | 23038323 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2,3-dimethoxy-6-methyl-4-propoxynaphthalen-1-yl) propanoate |
| SMILES | CCCOc1c(OC)c(OC)c(OC(=O)CC)c2ccc(C)cc12 |
| InChI | InChI=1S/C19H24O5/c1-6-10-23-16-14-11-12(3)8-9-13(14)17(24-15(20)7-2)19(22-5)18(16)21-4/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | MVHZXQQPSOXDEN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|