C23H30O6 — CID 23038432
[4-(2,2-dimethylpropanoyloxy)-2,3-dimethoxy-6-methylnaphthalen-1-yl] pentanoate (PubChem CID 23038432) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoyloxy)-2,3-dimethoxy-6-methylnaphthalen-1-yl] pentanoate.
| Compound Name | [4-(2,2-dimethylpropanoyloxy)-2,3-dimethoxy-6-methylnaphthalen-1-yl] pentanoate |
|---|---|
| PubChem CID | 23038432 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [4-(2,2-dimethylpropanoyloxy)-2,3-dimethoxy-6-methylnaphthalen-1-yl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(OC)c(OC)c(OC(=O)C(C)(C)C)c2cc(C)ccc12 |
| InChI | InChI=1S/C23H30O6/c1-8-9-10-17(24)28-18-15-12-11-14(2)13-16(15)19(21(27-7)20(18)26-6)29-22(25)23(3,4)5/h11-13H,8-10H2,1-7H3 |
| InChIKey | OSBPVQYWHJMLBO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|