C27H40O5 — CID 56613078
(4-butan-2-yloxy-2,3-dimethoxy-6-propan-2-ylnaphthalen-1-yl) octanoate (PubChem CID 56613078) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is (4-butan-2-yloxy-2,3-dimethoxy-6-propan-2-ylnaphthalen-1-yl) octanoate.
| Compound Name | (4-butan-2-yloxy-2,3-dimethoxy-6-propan-2-ylnaphthalen-1-yl) octanoate |
|---|---|
| PubChem CID | 56613078 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (4-butan-2-yloxy-2,3-dimethoxy-6-propan-2-ylnaphthalen-1-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(OC)c(OC)c(OC(C)CC)c2cc(C(C)C)ccc12 |
| InChI | InChI=1S/C27H40O5/c1-8-10-11-12-13-14-23(28)32-24-21-16-15-20(18(3)4)17-22(21)25(31-19(5)9-2)27(30-7)26(24)29-6/h15-19H,8-14H2,1-7H3 |
| InChIKey | XXSQUHHDMNDSSI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|