C24H31ClO6 — CID 54036580
[6-chloro-2,3-dimethoxy-4-(2-methylpropanoyloxy)naphthalen-1-yl] octanoate (PubChem CID 54036580) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is [6-chloro-2,3-dimethoxy-4-(2-methylpropanoyloxy)naphthalen-1-yl] octanoate.
| Compound Name | [6-chloro-2,3-dimethoxy-4-(2-methylpropanoyloxy)naphthalen-1-yl] octanoate |
|---|---|
| PubChem CID | 54036580 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [6-chloro-2,3-dimethoxy-4-(2-methylpropanoyloxy)naphthalen-1-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(OC)c(OC)c(OC(=O)C(C)C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C24H31ClO6/c1-6-7-8-9-10-11-19(26)30-20-17-13-12-16(25)14-18(17)21(31-24(27)15(2)3)23(29-5)22(20)28-4/h12-15H,6-11H2,1-5H3 |
| InChIKey | LJJOYYFXFINBBB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|