C20H26O6 — CID 23038882
(4-ethoxy-2,3,7-trimethoxynaphthalen-1-yl) pentanoate (PubChem CID 23038882) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (4-ethoxy-2,3,7-trimethoxynaphthalen-1-yl) pentanoate.
| Compound Name | (4-ethoxy-2,3,7-trimethoxynaphthalen-1-yl) pentanoate |
|---|---|
| PubChem CID | 23038882 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (4-ethoxy-2,3,7-trimethoxynaphthalen-1-yl) pentanoate |
| SMILES | CCCCC(=O)Oc1c(OC)c(OC)c(OCC)c2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26O6/c1-6-8-9-16(21)26-18-15-12-13(22-3)10-11-14(15)17(25-7-2)19(23-4)20(18)24-5/h10-12H,6-9H2,1-5H3 |
| InChIKey | DVTFYPOTWJQGCZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|