C26H30O8 — CID 159620499
methyl 4-[9,10-dimethoxy-6-(4-methoxy-4-oxobutoxy)anthracen-2-yl]oxybutanoate (PubChem CID 159620499) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is methyl 4-[9,10-dimethoxy-6-(4-methoxy-4-oxobutoxy)anthracen-2-yl]oxybutanoate.
| Compound Name | methyl 4-[9,10-dimethoxy-6-(4-methoxy-4-oxobutoxy)anthracen-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 159620499 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | methyl 4-[9,10-dimethoxy-6-(4-methoxy-4-oxobutoxy)anthracen-2-yl]oxybutanoate |
| SMILES | COC(=O)CCCOc1ccc2c(OC)c3cc(OCCCC(=O)OC)ccc3c(OC)c2c1 |
| InChI | InChI=1S/C26H30O8/c1-29-23(27)7-5-13-33-17-9-11-19-21(15-17)25(31-3)20-12-10-18(16-22(20)26(19)32-4)34-14-6-8-24(28)30-2/h9-12,15-16H,5-8,13-14H2,1-4H3 |
| InChIKey | ZFSSHXSNTIWMMW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|