C21H25FO6 — CID 23038843
(4-acetyloxy-7-fluoro-2,3-dimethoxynaphthalen-1-yl) heptanoate (PubChem CID 23038843) has the molecular formula C21H25FO6 and a molecular weight of 392.42 g/mol. Its IUPAC name is (4-acetyloxy-7-fluoro-2,3-dimethoxynaphthalen-1-yl) heptanoate.
| Compound Name | (4-acetyloxy-7-fluoro-2,3-dimethoxynaphthalen-1-yl) heptanoate |
|---|---|
| PubChem CID | 23038843 |
| Molecular Formula | C21H25FO6 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (4-acetyloxy-7-fluoro-2,3-dimethoxynaphthalen-1-yl) heptanoate |
| SMILES | CCCCCCC(=O)Oc1c(OC)c(OC)c(OC(C)=O)c2ccc(F)cc12 |
| InChI | InChI=1S/C21H25FO6/c1-5-6-7-8-9-17(24)28-19-16-12-14(22)10-11-15(16)18(27-13(2)23)20(25-3)21(19)26-4/h10-12H,5-9H2,1-4H3 |
| InChIKey | MQKVGELNQUZQEU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|