C23H31ClO5 — CID 149158598
(6-chloro-2,3-dimethoxy-4-propoxynaphthalen-1-yl) octanoate (PubChem CID 149158598) has the molecular formula C23H31ClO5 and a molecular weight of 422.95 g/mol. Its IUPAC name is (6-chloro-2,3-dimethoxy-4-propoxynaphthalen-1-yl) octanoate.
| Compound Name | (6-chloro-2,3-dimethoxy-4-propoxynaphthalen-1-yl) octanoate |
|---|---|
| PubChem CID | 149158598 |
| Molecular Formula | C23H31ClO5 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (6-chloro-2,3-dimethoxy-4-propoxynaphthalen-1-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(OC)c(OC)c(OCCC)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C23H31ClO5/c1-5-7-8-9-10-11-19(25)29-21-17-13-12-16(24)15-18(17)20(28-14-6-2)22(26-3)23(21)27-4/h12-13,15H,5-11,14H2,1-4H3 |
| InChIKey | GXJUQXPJGQYVST-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|