C16H17ClO5 — CID 23038661
(6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) butanoate (PubChem CID 23038661) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) butanoate.
| Compound Name | (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 23038661 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) butanoate |
| SMILES | CCCC(=O)Oc1c(OC)c(OC)c(O)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H17ClO5/c1-4-5-12(18)22-14-10-7-6-9(17)8-11(10)13(19)15(20-2)16(14)21-3/h6-8,19H,4-5H2,1-3H3 |
| InChIKey | URGXQMMMKKDWGT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|