C26H21ClO5 — CID 23038223
(7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) butanoate (PubChem CID 23038223) has the molecular formula C26H21ClO5 and a molecular weight of 448.90 g/mol. Its IUPAC name is (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) butanoate.
| Compound Name | (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 23038223 |
| Molecular Formula | C26H21ClO5 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (7-chloro-4-hydroxy-2,3-diphenoxynaphthalen-1-yl) butanoate |
| SMILES | CCCC(=O)Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(O)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H21ClO5/c1-2-9-22(28)32-24-21-16-17(27)14-15-20(21)23(29)25(30-18-10-5-3-6-11-18)26(24)31-19-12-7-4-8-13-19/h3-8,10-16,29H,2,9H2,1H3 |
| InChIKey | IKZPTPBDIUVKOQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|