About (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate
(4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate (PubChem CID 23038618) has the molecular formula C29H26O6
and a molecular weight of 470.52 g/mol. Its IUPAC name is (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate.
Molecular Properties
| Compound Name | (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate |
| PubChem CID | 23038618 |
| Molecular Formula | C29H26O6 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate |
| SMILES | CCCCC(=O)Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C29H26O6/c1-3-4-19-25(31)35-27-24-18-12-11-17-23(24)26(32-20(2)30)28(33-21-13-7-5-8-14-21)29(27)34-22-15-9-6-10-16-22/h5-18H,3-4,19H2,1-2H3 |
| InChIKey | AIUKSFDVMORJKO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate?
The IUPAC name of (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate (CID 23038618) is (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate.
What is the SMILES notation for (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate?
The canonical SMILES for (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate is CCCCC(=O)Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(OC(C)=O)c2ccccc12.
What is the InChIKey of (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate?
The InChIKey is AIUKSFDVMORJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26O6/c1-3-4-19-25(31)35-27-24-18-12-11-17-23(24)26(32-20(2)30)28(33-21-13-7-5-8-14-21)29(27)34-22-15-9-6-10-16-22/h5-18H,3-4,19H2,1-2H3.
What are the key properties of (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate?
(4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate has a molecular weight of 470.52 g/mol, XLogP of 7.45, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxy-2,3-diphenoxynaphthalen-1-yl) pentanoate is sourced from PubChem (CID 23038618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).